C17H14N8O3 — CID 173457767
1,2-bis[(E)-(4-cyanophenyl)methylideneamino]guanidine;nitric acid (PubChem CID 173457767) has the molecular formula C17H14N8O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 1,2-bis[(E)-(4-cyanophenyl)methylideneamino]guanidine;nitric acid.
| Compound Name | 1,2-bis[(E)-(4-cyanophenyl)methylideneamino]guanidine;nitric acid |
|---|---|
| PubChem CID | 173457767 |
| Molecular Formula | C17H14N8O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1,2-bis[(E)-(4-cyanophenyl)methylideneamino]guanidine;nitric acid |
| SMILES | N#Cc1ccc(/C=N/N=C(N)N/N=C/c2ccc(C#N)cc2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C17H13N7.HNO3/c18-9-13-1-5-15(6-2-13)11-21-23-17(20)24-22-12-16-7-3-14(10-19)4-8-16;2-1(3)4/h1-8,11-12H,(H3,20,23,24);(H,2,3,4)/b21-11+,22-12+; |
| InChIKey | AWPIYHIVWRIAPB-XHPUXTPKSA-N |
| XLogP | 1.35 |
| TPSA | 186.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|