C15H13N7O6 — CID 137255813
1,2-bis[(4-hydroxy-3-nitrophenyl)methylideneamino]guanidine (PubChem CID 137255813) has the molecular formula C15H13N7O6 and a molecular weight of 387.31 g/mol. Its IUPAC name is 1,2-bis[(4-hydroxy-3-nitrophenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(4-hydroxy-3-nitrophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 137255813 |
| Molecular Formula | C15H13N7O6 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1,2-bis[(4-hydroxy-3-nitrophenyl)methylideneamino]guanidine |
| SMILES | NC(=NN=Cc1ccc(O)c([N+](=O)[O-])c1)NN=Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13N7O6/c16-15(19-17-7-9-1-3-13(23)11(5-9)21(25)26)20-18-8-10-2-4-14(24)12(6-10)22(27)28/h1-8,23-24H,(H3,16,19,20) |
| InChIKey | TVQABBICUNSDBP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 201.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|