C19H18N6O8 — CID 136803489
2-ethyl-N,N'-bis[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide (PubChem CID 136803489) has the molecular formula C19H18N6O8 and a molecular weight of 458.39 g/mol. Its IUPAC name is 2-ethyl-N,N'-bis[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide.
| Compound Name | 2-ethyl-N,N'-bis[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 136803489 |
| Molecular Formula | C19H18N6O8 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-ethyl-N,N'-bis[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide |
| SMILES | CCC(C(=O)N/N=C\c1ccc(O)c([N+](=O)[O-])c1)C(=O)N/N=C\c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N6O8/c1-2-13(18(28)22-20-9-11-3-5-16(26)14(7-11)24(30)31)19(29)23-21-10-12-4-6-17(27)15(8-12)25(32)33/h3-10,13,26-27H,2H2,1H3,(H,22,28)(H,23,29)/b20-9-,21-10- |
| InChIKey | ZBNNZJFFEMFWTP-UPVMUGGESA-N |
| XLogP | 1.54 |
| TPSA | 209.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|