C10H10N4O5 — CID 135813963
N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-methyloxamide (PubChem CID 135813963) has the molecular formula C10H10N4O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-methyloxamide.
| Compound Name | N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-methyloxamide |
|---|---|
| PubChem CID | 135813963 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)N/N=C/c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N4O5/c1-11-9(16)10(17)13-12-5-6-2-3-8(15)7(4-6)14(18)19/h2-5,15H,1H3,(H,11,16)(H,13,17)/b12-5+ |
| InChIKey | RXXDWEPQGVJLOD-LFYBBSHMSA-N |
| XLogP | -0.50 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|