C17H16N4O5 — CID 135813942
N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(2-phenylethyl)oxamide (PubChem CID 135813942) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(2-phenylethyl)oxamide.
| Compound Name | N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 135813942 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(2-phenylethyl)oxamide |
| SMILES | O=C(NCCc1ccccc1)C(=O)N/N=C\c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O5/c22-15-7-6-13(10-14(15)21(25)26)11-19-20-17(24)16(23)18-9-8-12-4-2-1-3-5-12/h1-7,10-11,22H,8-9H2,(H,18,23)(H,20,24)/b19-11- |
| InChIKey | KYPBJPNUDAHPGV-ODLFYWEKSA-N |
| XLogP | 1.11 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|