C16H14N4O5 — CID 4567494
N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-phenylpropanediamide (PubChem CID 4567494) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-phenylpropanediamide.
| Compound Name | N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-phenylpropanediamide |
|---|---|
| PubChem CID | 4567494 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-phenylpropanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1)NN=Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N4O5/c21-14-7-6-11(8-13(14)20(24)25)10-17-19-16(23)9-15(22)18-12-4-2-1-3-5-12/h1-8,10,21H,9H2,(H,18,22)(H,19,23) |
| InChIKey | PWYXPNKFFNOHQP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|