C17H16N4O6 — CID 135842138
N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide (PubChem CID 135842138) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide.
| Compound Name | N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 135842138 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide |
| SMILES | COc1ccc(NC(=O)CC(=O)N/N=C/c2ccc(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H16N4O6/c1-27-13-5-3-12(4-6-13)19-16(23)9-17(24)20-18-10-11-2-7-15(22)14(8-11)21(25)26/h2-8,10,22H,9H2,1H3,(H,19,23)(H,20,24)/b18-10+ |
| InChIKey | BHFVJGMEBTVVLU-VCHYOVAHSA-N |
| XLogP | 1.79 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|