C17H13F3N4O5 — CID 3653365
N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 3653365) has the molecular formula C17H13F3N4O5 and a molecular weight of 410.31 g/mol. Its IUPAC name is N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 3653365 |
| Molecular Formula | C17H13F3N4O5 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N'-[(4-hydroxy-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(C(F)(F)F)c1)NN=Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13F3N4O5/c18-17(19,20)11-2-1-3-12(7-11)22-15(26)8-16(27)23-21-9-10-4-5-14(25)13(6-10)24(28)29/h1-7,9,25H,8H2,(H,22,26)(H,23,27) |
| InChIKey | BHMSNKGLAGSMIK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|