C16H14F3N3O3 — CID 136852090
N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 136852090) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 136852090 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)N/N=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H14F3N3O3/c17-16(18,19)11-2-1-3-12(7-11)20-9-15(25)22-21-8-10-4-5-13(23)14(24)6-10/h1-8,20,23-24H,9H2,(H,22,25)/b21-8- |
| InChIKey | ZECAALNHELPNHX-WNFQYIGGSA-N |
| XLogP | 2.68 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|