C16H13BrF3N3O2 — CID 135717023
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 135717023) has the molecular formula C16H13BrF3N3O2 and a molecular weight of 416.20 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 135717023 |
| Molecular Formula | C16H13BrF3N3O2 |
| Molecular Weight | 416.20 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H13BrF3N3O2/c17-12-4-5-14(24)10(6-12)8-22-23-15(25)9-21-13-3-1-2-11(7-13)16(18,19)20/h1-8,21,24H,9H2,(H,23,25)/b22-8+ |
| InChIKey | ULFUDOLIKXFCQD-GZIVZEMBSA-N |
| XLogP | 3.74 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|