C16H12Cl2F3N3O — CID 2353624
N-[(3,4-dichlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 2353624) has the molecular formula C16H12Cl2F3N3O and a molecular weight of 390.19 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 2353624 |
| Molecular Formula | C16H12Cl2F3N3O |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)NN=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2F3N3O/c17-13-5-4-10(6-14(13)18)8-23-24-15(25)9-22-12-3-1-2-11(7-12)16(19,20)21/h1-8,22H,9H2,(H,24,25) |
| InChIKey | AIOWTRLPFAUVTK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|