C18H19Cl2N3O — CID 5016763
2-(3,4-dichloroanilino)-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide (PubChem CID 5016763) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dichloroanilino)-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5016763 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(3,4-dichloroanilino)-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide |
| SMILES | CC(C)c1ccc(C=NNC(=O)CNc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O/c1-12(2)14-5-3-13(4-6-14)10-22-23-18(24)11-21-15-7-8-16(19)17(20)9-15/h3-10,12,21H,11H2,1-2H3,(H,23,24) |
| InChIKey | NYSPJJLHIPKACZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|