C25H27N3O — CID 4545872
N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 4545872) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 4545872 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | CC(C=NNC(=O)CNc1ccc2ccccc2c1)=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H27N3O/c1-18(2)21-10-8-20(9-11-21)14-19(3)16-27-28-25(29)17-26-24-13-12-22-6-4-5-7-23(22)15-24/h4-16,18,26H,17H2,1-3H3,(H,28,29) |
| InChIKey | BJIJTYIMSWIZNC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|