C22H25Br2N3O — CID 4028495
2-(2,6-dibromo-4-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]acetamide (PubChem CID 4028495) has the molecular formula C22H25Br2N3O and a molecular weight of 507.27 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 4028495 |
| Molecular Formula | C22H25Br2N3O |
| Molecular Weight | 507.27 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 2-(2,6-dibromo-4-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]acetamide |
| SMILES | CC(C=NNC(=O)CNc1c(Br)cc(C)cc1Br)=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H25Br2N3O/c1-14(2)18-7-5-17(6-8-18)9-16(4)12-26-27-21(28)13-25-22-19(23)10-15(3)11-20(22)24/h5-12,14,25H,13H2,1-4H3,(H,27,28) |
| InChIKey | UKMPYBLTJCJTGG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.27 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|