C24H30ClN3O — CID 5101093
2-(4-chloro-2-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]butanamide (PubChem CID 5101093) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 2-(4-chloro-2-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]butanamide.
| Compound Name | 2-(4-chloro-2-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]butanamide |
|---|---|
| PubChem CID | 5101093 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-(4-chloro-2-methylanilino)-N-[[2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]butanamide |
| SMILES | CCC(Nc1ccc(Cl)cc1C)C(=O)NN=CC(C)=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H30ClN3O/c1-6-22(27-23-12-11-21(25)14-18(23)5)24(29)28-26-15-17(4)13-19-7-9-20(10-8-19)16(2)3/h7-16,22,27H,6H2,1-5H3,(H,28,29) |
| InChIKey | OAKYMHYUFYJLQB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|