C19H22N4O3 — CID 5430531
(2R)-2-(2,4-dimethylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]butanamide (PubChem CID 5430531) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]butanamide.
| Compound Name | (2R)-2-(2,4-dimethylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 5430531 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2R)-2-(2,4-dimethylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]butanamide |
| SMILES | CC[C@@H](Nc1ccc(C)cc1C)C(=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-4-17(21-18-10-5-13(2)11-14(18)3)19(24)22-20-12-15-6-8-16(9-7-15)23(25)26/h5-12,17,21H,4H2,1-3H3,(H,22,24)/b20-12-/t17-/m1/s1 |
| InChIKey | CTKHDSSFNLWURH-SYERDGIWSA-N |
| XLogP | 3.55 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|