C21H24N4O2 — CID 45356627
2-ethyl-N,N'-bis[(E)-(4-methylphenyl)methylideneamino]propanediamide (PubChem CID 45356627) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-ethyl-N,N'-bis[(E)-(4-methylphenyl)methylideneamino]propanediamide.
| Compound Name | 2-ethyl-N,N'-bis[(E)-(4-methylphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 45356627 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-ethyl-N,N'-bis[(E)-(4-methylphenyl)methylideneamino]propanediamide |
| SMILES | CCC(C(=O)N/N=C/c1ccc(C)cc1)C(=O)N/N=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-4-19(20(26)24-22-13-17-9-5-15(2)6-10-17)21(27)25-23-14-18-11-7-16(3)8-12-18/h5-14,19H,4H2,1-3H3,(H,24,26)(H,25,27)/b22-13+,23-14+ |
| InChIKey | ZYCXNVKBLVUHHI-MSKUYSOUSA-N |
| XLogP | 2.93 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|