C21H26N2O2S — CID 126134346
(2S)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 126134346) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is (2S)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126134346 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2S)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)[C@H](C)Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O2S/c1-4-5-14-25-19-10-8-18(9-11-19)15-22-23-21(24)17(3)26-20-12-6-16(2)7-13-20/h6-13,15,17H,4-5,14H2,1-3H3,(H,23,24)/b22-15-/t17-/m0/s1 |
| InChIKey | RIRNUVBCIJQJNB-WPGBELRESA-N |
| XLogP | 4.80 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|