C24H23ClN2O2S — CID 126137049
(2R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 126137049) has the molecular formula C24H23ClN2O2S and a molecular weight of 438.98 g/mol. Its IUPAC name is (2R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126137049 |
| Molecular Formula | C24H23ClN2O2S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (2R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(S[C@H](C)C(=O)N/N=C\c2ccc(OCc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H23ClN2O2S/c1-17-3-13-23(14-4-17)30-18(2)24(28)27-26-15-19-7-11-22(12-8-19)29-16-20-5-9-21(25)10-6-20/h3-15,18H,16H2,1-2H3,(H,27,28)/b26-15-/t18-/m1/s1 |
| InChIKey | WETUVEMRLPPHCK-WTTSBOSASA-N |
| XLogP | 5.86 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|