C23H28N2O4S — CID 126148037
tert-butyl 2-[4-[(Z)-[[(2S)-2-(4-methylphenyl)sulfanylpropanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126148037) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is tert-butyl 2-[4-[(Z)-[[(2S)-2-(4-methylphenyl)sulfanylpropanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(Z)-[[(2S)-2-(4-methylphenyl)sulfanylpropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126148037 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | tert-butyl 2-[4-[(Z)-[[(2S)-2-(4-methylphenyl)sulfanylpropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)N/N=C\c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-16-6-12-20(13-7-16)30-17(2)22(27)25-24-14-18-8-10-19(11-9-18)28-15-21(26)29-23(3,4)5/h6-14,17H,15H2,1-5H3,(H,25,27)/b24-14-/t17-/m0/s1 |
| InChIKey | WOIVMSZZDOZMFV-PDESAOGPSA-N |
| XLogP | 4.35 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|