C33H39NO7 — CID 159406771
tert-butyl 2-(4-formylphenoxy)acetate;tert-butyl 2-[4-[(4-methylphenyl)iminomethyl]phenoxy]acetate (PubChem CID 159406771) has the molecular formula C33H39NO7 and a molecular weight of 561.68 g/mol. Its IUPAC name is tert-butyl 2-(4-formylphenoxy)acetate;tert-butyl 2-[4-[(4-methylphenyl)iminomethyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-(4-formylphenoxy)acetate;tert-butyl 2-[4-[(4-methylphenyl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 159406771 |
| Molecular Formula | C33H39NO7 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | tert-butyl 2-(4-formylphenoxy)acetate;tert-butyl 2-[4-[(4-methylphenyl)iminomethyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(C=O)cc1.Cc1ccc(/N=C/c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H23NO3.C13H16O4/c1-15-5-9-17(10-6-15)21-13-16-7-11-18(12-8-16)23-14-19(22)24-20(2,3)4;1-13(2,3)17-12(15)9-16-11-6-4-10(8-14)5-7-11/h5-13H,14H2,1-4H3;4-8H,9H2,1-3H3/b21-13+; |
| InChIKey | LOBFPWQSGUIYQD-PGCULMPHSA-N |
| XLogP | 6.69 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|