C20H21BrN2O4 — CID 3937671
tert-butyl 2-[4-[[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3937671) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is tert-butyl 2-[4-[[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3937671 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | tert-butyl 2-[4-[[(4-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(C=NNC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H21BrN2O4/c1-20(2,3)27-18(24)13-26-17-10-4-14(5-11-17)12-22-23-19(25)15-6-8-16(21)9-7-15/h4-12H,13H2,1-3H3,(H,23,25) |
| InChIKey | HCNMJUDFHMAWMS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|