C24H24N2O5 — CID 3791292
tert-butyl 2-[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3791292) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is tert-butyl 2-[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3791292 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | tert-butyl 2-[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(C=NNC(=O)c2cc3ccccc3cc2O)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-24(2,3)31-22(28)15-30-19-10-8-16(9-11-19)14-25-26-23(29)20-12-17-6-4-5-7-18(17)13-21(20)27/h4-14,27H,15H2,1-3H3,(H,26,29) |
| InChIKey | GYHFMFBWKHOCKD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|