C25H21N3O2 — CID 6903267
3-hydroxy-N-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]naphthalene-2-carboxamide (PubChem CID 6903267) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-hydroxy-N-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6903267 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-hydroxy-N-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]naphthalene-2-carboxamide |
| SMILES | CN(c1ccccc1)c1ccc(/C=N/NC(=O)c2cc3ccccc3cc2O)cc1 |
| InChI | InChI=1S/C25H21N3O2/c1-28(21-9-3-2-4-10-21)22-13-11-18(12-14-22)17-26-27-25(30)23-15-19-7-5-6-8-20(19)16-24(23)29/h2-17,29H,1H3,(H,27,30)/b26-17+ |
| InChIKey | VIYYPYQIYUCJOF-YZSQISJMSA-N |
| XLogP | 5.08 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|