C18H14N2O2 — CID 689876
N-(benzylideneamino)-3-hydroxynaphthalene-2-carboxamide (PubChem CID 689876) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(benzylideneamino)-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-(benzylideneamino)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 689876 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(benzylideneamino)-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H14N2O2/c21-17-11-15-9-5-4-8-14(15)10-16(17)18(22)20-19-12-13-6-2-1-3-7-13/h1-12,21H,(H,20,22) |
| InChIKey | BQTYCKJHLIHXHX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|