C25H20N2O6S — CID 171136023
[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 171136023) has the molecular formula C25H20N2O6S and a molecular weight of 476.51 g/mol. Its IUPAC name is [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 171136023 |
| Molecular Formula | C25H20N2O6S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc(C=NNC(=O)c3cc4ccccc4cc3O)cc2)cc1 |
| InChI | InChI=1S/C25H20N2O6S/c1-32-20-10-12-22(13-11-20)34(30,31)33-21-8-6-17(7-9-21)16-26-27-25(29)23-14-18-4-2-3-5-19(18)15-24(23)28/h2-16,28H,1H3,(H,27,29) |
| InChIKey | CXCVPDNNKJZPTC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|