C22H20N2O5S — CID 6043565
[4-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 6043565) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is [4-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 6043565 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [4-[(Z)-[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-16-3-13-21(14-4-16)30(26,27)29-20-9-5-17(6-10-20)15-23-24-22(25)18-7-11-19(28-2)12-8-18/h3-15H,1-2H3,(H,24,25)/b23-15- |
| InChIKey | DFQRLDUEFQSUEK-HAHDFKILSA-N |
| XLogP | 3.54 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|