C20H21N2O4- — CID 9466108
2-[4-[(Z)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 9466108) has the molecular formula C20H21N2O4- and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9466108 |
| Molecular Formula | C20H21N2O4- |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[4-[(Z)-[(4-tert-butylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)N/N=C\c2ccc(OCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-20(2,3)16-8-6-15(7-9-16)19(25)22-21-12-14-4-10-17(11-5-14)26-13-18(23)24/h4-12H,13H2,1-3H3,(H,22,25)(H,23,24)/p-1/b21-12- |
| InChIKey | JRBPYWJWGOJBQE-MTJSOVHGSA-M |
| XLogP | 1.88 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|