C19H16N2O8-2 — CID 4617566
2-[2-(carboxylatomethoxy)-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4617566) has the molecular formula C19H16N2O8-2 and a molecular weight of 400.34 g/mol. Its IUPAC name is 2-[2-(carboxylatomethoxy)-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-(carboxylatomethoxy)-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4617566 |
| Molecular Formula | C19H16N2O8-2 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-[2-(carboxylatomethoxy)-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COc1ccc(C(=O)NN=Cc2ccc(OCC(=O)[O-])c(OCC(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H18N2O8/c1-27-14-5-3-13(4-6-14)19(26)21-20-9-12-2-7-15(28-10-17(22)23)16(8-12)29-11-18(24)25/h2-9H,10-11H2,1H3,(H,21,26)(H,22,23)(H,24,25)/p-2 |
| InChIKey | HWVIEXUMHZOJRW-UHFFFAOYSA-L |
| XLogP | -1.28 |
| TPSA | 149.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|