C26H25N3O2 — CID 2470036
4-[(4-tert-butylphenoxy)methyl]-N-[(4-cyanophenyl)methylideneamino]benzamide (PubChem CID 2470036) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-N-[(4-cyanophenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-N-[(4-cyanophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2470036 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-N-[(4-cyanophenyl)methylideneamino]benzamide |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)NN=Cc3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-26(2,3)23-12-14-24(15-13-23)31-18-21-8-10-22(11-9-21)25(30)29-28-17-20-6-4-19(16-27)5-7-20/h4-15,17H,18H2,1-3H3,(H,29,30) |
| InChIKey | FHDCSGUXPWARMV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|