C26H26N2O4 — CID 6164401
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-tert-butylphenoxy)methyl]benzamide (PubChem CID 6164401) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-tert-butylphenoxy)methyl]benzamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-tert-butylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 6164401 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-tert-butylphenoxy)methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)N/N=C\c3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O4/c1-26(2,3)21-9-11-22(12-10-21)30-16-18-4-7-20(8-5-18)25(29)28-27-15-19-6-13-23-24(14-19)32-17-31-23/h4-15H,16-17H2,1-3H3,(H,28,29)/b27-15- |
| InChIKey | DRVABLYUHTZRJC-DICXZTSXSA-N |
| XLogP | 5.06 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|