C23H19IN2O5 — CID 6873437
N-[(E)-[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 6873437) has the molecular formula C23H19IN2O5 and a molecular weight of 530.32 g/mol. Its IUPAC name is N-[(E)-[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6873437 |
| Molecular Formula | C23H19IN2O5 |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | N-[(E)-[3-[(4-iodophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc3c(c2)OCO3)cc1COc1ccc(I)cc1 |
| InChI | InChI=1S/C23H19IN2O5/c1-28-20-8-2-15(10-17(20)13-29-19-6-4-18(24)5-7-19)12-25-26-23(27)16-3-9-21-22(11-16)31-14-30-21/h2-12H,13-14H2,1H3,(H,26,27)/b25-12+ |
| InChIKey | UXGMJVFCYYNKHL-BRJLIKDPSA-N |
| XLogP | 4.37 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|