C19H16N6O6 — CID 6264010
N-[(Z)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 6264010) has the molecular formula C19H16N6O6 and a molecular weight of 424.37 g/mol. Its IUPAC name is N-[(Z)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6264010 |
| Molecular Formula | C19H16N6O6 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[(Z)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccc3c(c2)OCO3)cc1Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H16N6O6/c1-29-15-4-2-12(6-14(15)9-24-10-20-19(23-24)25(27)28)8-21-22-18(26)13-3-5-16-17(7-13)31-11-30-16/h2-8,10H,9,11H2,1H3,(H,22,26)/b21-8- |
| InChIKey | UNSKYWKMAIHTJL-WNFQYIGGSA-N |
| XLogP | 1.74 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|