C18H15N6O7- — CID 59286427
2,6-dihydroxy-4-[[(E)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]carbamoyl]phenolate (PubChem CID 59286427) has the molecular formula C18H15N6O7- and a molecular weight of 427.35 g/mol. Its IUPAC name is 2,6-dihydroxy-4-[[(E)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]carbamoyl]phenolate.
| Compound Name | 2,6-dihydroxy-4-[[(E)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]carbamoyl]phenolate |
|---|---|
| PubChem CID | 59286427 |
| Molecular Formula | C18H15N6O7- |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2,6-dihydroxy-4-[[(E)-[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]carbamoyl]phenolate |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(O)c([O-])c(O)c2)cc1Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H16N6O7/c1-31-15-3-2-10(4-12(15)8-23-9-19-18(22-23)24(29)30)7-20-21-17(28)11-5-13(25)16(27)14(26)6-11/h2-7,9,25-27H,8H2,1H3,(H,21,28)/p-1/b20-7+ |
| InChIKey | BTAFNYPXKKFPHL-IFRROFPPSA-M |
| XLogP | 0.49 |
| TPSA | 188.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|