C20H18BrN5O5 — CID 46496630
N-[(E)-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide (PubChem CID 46496630) has the molecular formula C20H18BrN5O5 and a molecular weight of 488.30 g/mol. Its IUPAC name is N-[(E)-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(E)-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 46496630 |
| Molecular Formula | C20H18BrN5O5 |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | N-[(E)-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccccc2O)cc1Cn1nc([N+](=O)[O-])c(Br)c1C |
| InChI | InChI=1S/C20H18BrN5O5/c1-12-18(21)19(26(29)30)24-25(12)11-14-9-13(7-8-17(14)31-2)10-22-23-20(28)15-5-3-4-6-16(15)27/h3-10,27H,11H2,1-2H3,(H,23,28)/b22-10+ |
| InChIKey | GHFRKSVVNXGEAV-LSHDLFTRSA-N |
| XLogP | 3.39 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|