C20H22BrN7O4 — CID 3537436
N-[[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide (PubChem CID 3537436) has the molecular formula C20H22BrN7O4 and a molecular weight of 504.35 g/mol. Its IUPAC name is N-[[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 3537436 |
| Molecular Formula | C20H22BrN7O4 |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
| SMILES | COc1ccc(C=NNC(=O)Cn2nc([N+](=O)[O-])cc2C)cc1Cn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C20H22BrN7O4/c1-12-7-18(28(30)31)25-26(12)11-19(29)23-22-9-15-5-6-17(32-4)16(8-15)10-27-14(3)20(21)13(2)24-27/h5-9H,10-11H2,1-4H3,(H,23,29) |
| InChIKey | LRCHUIJPVCMINL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|