C20H20BrN5O2 — CID 46495342
N-[(E)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 46495342) has the molecular formula C20H20BrN5O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is N-[(E)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46495342 |
| Molecular Formula | C20H20BrN5O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[(E)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccncc2)cc1Cn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C20H20BrN5O2/c1-13-19(21)14(2)26(25-13)12-17-10-15(4-5-18(17)28-3)11-23-24-20(27)16-6-8-22-9-7-16/h4-11H,12H2,1-3H3,(H,24,27)/b23-11+ |
| InChIKey | PIWIJBAQOXHEBY-FOKLQQMPSA-N |
| XLogP | 3.48 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|