C19H23N4O3+ — CID 7741045
N-[(Z)-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 7741045) has the molecular formula C19H23N4O3+ and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[(Z)-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 7741045 |
| Molecular Formula | C19H23N4O3+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[(Z)-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccncc2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H22N4O3/c1-25-18-3-2-15(12-17(18)14-23-8-10-26-11-9-23)13-21-22-19(24)16-4-6-20-7-5-16/h2-7,12-13H,8-11,14H2,1H3,(H,22,24)/p+1/b21-13- |
| InChIKey | OARHEGYIRIJQOA-BKUYFWCQSA-O |
| XLogP | 0.27 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|