C22H27N4O4+ — CID 7335954
N-[2-[(2Z)-2-[[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 7335954) has the molecular formula C22H27N4O4+ and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(2Z)-2-[[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 7335954 |
| Molecular Formula | C22H27N4O4+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[2-[(2Z)-2-[[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(/C=N\NC(=O)CNC(=O)c2ccccc2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H26N4O4/c1-29-20-8-7-17(13-19(20)16-26-9-11-30-12-10-26)14-24-25-21(27)15-23-22(28)18-5-3-2-4-6-18/h2-8,13-14H,9-12,15-16H2,1H3,(H,23,28)(H,25,27)/p+1/b24-14- |
| InChIKey | RMURHJZGWZLFGD-OYKKKHCWSA-O |
| XLogP | -0.01 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|