C20H18BrCl3N4O — CID 6114960
N-[(Z)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2,4,6-trichloroaniline (PubChem CID 6114960) has the molecular formula C20H18BrCl3N4O and a molecular weight of 516.65 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2,4,6-trichloroaniline.
| Compound Name | N-[(Z)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2,4,6-trichloroaniline |
|---|---|
| PubChem CID | 6114960 |
| Molecular Formula | C20H18BrCl3N4O |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | N-[(Z)-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-2,4,6-trichloroaniline |
| SMILES | COc1ccc(/C=N\Nc2c(Cl)cc(Cl)cc2Cl)cc1Cn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C20H18BrCl3N4O/c1-11-19(21)12(2)28(27-11)10-14-6-13(4-5-18(14)29-3)9-25-26-20-16(23)7-15(22)8-17(20)24/h4-9,26H,10H2,1-3H3/b25-9- |
| InChIKey | QKBHDXZRDKNGGN-MWYAZZEHSA-N |
| XLogP | 6.73 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|