C19H20Cl3N3O2 — CID 3791654
2,4,6-trichloro-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]aniline (PubChem CID 3791654) has the molecular formula C19H20Cl3N3O2 and a molecular weight of 428.75 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 3791654 |
| Molecular Formula | C19H20Cl3N3O2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2,4,6-trichloro-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]aniline |
| SMILES | COc1ccc(C=NNc2c(Cl)cc(Cl)cc2Cl)cc1CN1CCOCC1 |
| InChI | InChI=1S/C19H20Cl3N3O2/c1-26-18-3-2-13(8-14(18)12-25-4-6-27-7-5-25)11-23-24-19-16(21)9-15(20)10-17(19)22/h2-3,8-11,24H,4-7,12H2,1H3 |
| InChIKey | DKMSUTGKWDTTMX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|