C14H11Cl3N2O2 — CID 136853833
2-methoxy-4-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 136853833) has the molecular formula C14H11Cl3N2O2 and a molecular weight of 345.61 g/mol. Its IUPAC name is 2-methoxy-4-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-4-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136853833 |
| Molecular Formula | C14H11Cl3N2O2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2-methoxy-4-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N\Nc2c(Cl)cc(Cl)cc2Cl)ccc1O |
| InChI | InChI=1S/C14H11Cl3N2O2/c1-21-13-4-8(2-3-12(13)20)7-18-19-14-10(16)5-9(15)6-11(14)17/h2-7,19-20H,1H3/b18-7- |
| InChIKey | WPDRIMHRSZBVJH-WSVATBPTSA-N |
| XLogP | 4.81 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|