C20H14Cl3N3O3 — CID 4031795
[2-methoxy-4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate (PubChem CID 4031795) has the molecular formula C20H14Cl3N3O3 and a molecular weight of 450.71 g/mol. Its IUPAC name is [2-methoxy-4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [2-methoxy-4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4031795 |
| Molecular Formula | C20H14Cl3N3O3 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | [2-methoxy-4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
| SMILES | COc1cc(C=NNc2c(Cl)cc(Cl)cc2Cl)ccc1OC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H14Cl3N3O3/c1-28-18-7-12(10-25-26-19-15(22)8-14(21)9-16(19)23)4-5-17(18)29-20(27)13-3-2-6-24-11-13/h2-11,26H,1H3 |
| InChIKey | XKYKHQDOAPNBNF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|