C22H18FN3O5 — CID 6911090
[4-[(E)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] pyridine-3-carboxylate (PubChem CID 6911090) has the molecular formula C22H18FN3O5 and a molecular weight of 423.40 g/mol. Its IUPAC name is [4-[(E)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] pyridine-3-carboxylate.
| Compound Name | [4-[(E)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 6911090 |
| Molecular Formula | C22H18FN3O5 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [4-[(E)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] pyridine-3-carboxylate |
| SMILES | COc1cc(/C=N/NC(=O)COc2ccccc2F)ccc1OC(=O)c1cccnc1 |
| InChI | InChI=1S/C22H18FN3O5/c1-29-20-11-15(8-9-19(20)31-22(28)16-5-4-10-24-13-16)12-25-26-21(27)14-30-18-7-3-2-6-17(18)23/h2-13H,14H2,1H3,(H,26,27)/b25-12+ |
| InChIKey | YJZDOGRXTDAFBA-BRJLIKDPSA-N |
| XLogP | 2.98 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|