C16H13N5O3S2 — CID 9295306
[4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]-2-methoxyphenyl] pyridine-3-carboxylate (PubChem CID 9295306) has the molecular formula C16H13N5O3S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is [4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]-2-methoxyphenyl] pyridine-3-carboxylate.
| Compound Name | [4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]-2-methoxyphenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9295306 |
| Molecular Formula | C16H13N5O3S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | [4-[(Z)-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]iminomethyl]-2-methoxyphenyl] pyridine-3-carboxylate |
| SMILES | COc1cc(/C=N\n2c(=S)[nH][nH]c2=S)ccc1OC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H13N5O3S2/c1-23-13-7-10(8-18-21-15(25)19-20-16(21)26)4-5-12(13)24-14(22)11-3-2-6-17-9-11/h2-9H,1H3,(H,19,25)(H,20,26)/b18-8- |
| InChIKey | RCWMDMFYMGVRDK-LSCVHKIXSA-N |
| XLogP | 3.11 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|