C13H9Cl3N2O — CID 2841375
4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 2841375) has the molecular formula C13H9Cl3N2O and a molecular weight of 315.59 g/mol. Its IUPAC name is 4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 2841375 |
| Molecular Formula | C13H9Cl3N2O |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(C=NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H9Cl3N2O/c14-9-5-11(15)13(12(16)6-9)18-17-7-8-1-3-10(19)4-2-8/h1-7,18-19H |
| InChIKey | JPKNJIWZTHAODX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|