C15H9Cl3N4 — CID 4316664
2,4,6-trichloro-N-(quinoxalin-6-ylmethylideneamino)aniline (PubChem CID 4316664) has the molecular formula C15H9Cl3N4 and a molecular weight of 351.62 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(quinoxalin-6-ylmethylideneamino)aniline.
| Compound Name | 2,4,6-trichloro-N-(quinoxalin-6-ylmethylideneamino)aniline |
|---|---|
| PubChem CID | 4316664 |
| Molecular Formula | C15H9Cl3N4 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2,4,6-trichloro-N-(quinoxalin-6-ylmethylideneamino)aniline |
| SMILES | Clc1cc(Cl)c(NN=Cc2ccc3nccnc3c2)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl3N4/c16-10-6-11(17)15(12(18)7-10)22-21-8-9-1-2-13-14(5-9)20-4-3-19-13/h1-8,22H |
| InChIKey | DPWDMXYWAHQESY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|