C15H13Cl3N2 — CID 5223162
2,4,6-trichloro-N-[(4-ethylphenyl)methylideneamino]aniline (PubChem CID 5223162) has the molecular formula C15H13Cl3N2 and a molecular weight of 327.64 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(4-ethylphenyl)methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(4-ethylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 5223162 |
| Molecular Formula | C15H13Cl3N2 |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2,4,6-trichloro-N-[(4-ethylphenyl)methylideneamino]aniline |
| SMILES | CCc1ccc(C=NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3N2/c1-2-10-3-5-11(6-4-10)9-19-20-15-13(17)7-12(16)8-14(15)18/h3-9,20H,2H2,1H3 |
| InChIKey | HCZOFIUUHGMKMD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|