C14H8Cl3N3 — CID 4231773
4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]benzonitrile (PubChem CID 4231773) has the molecular formula C14H8Cl3N3 and a molecular weight of 324.60 g/mol. Its IUPAC name is 4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]benzonitrile.
| Compound Name | 4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 4231773 |
| Molecular Formula | C14H8Cl3N3 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 4-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]benzonitrile |
| SMILES | N#Cc1ccc(C=NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H8Cl3N3/c15-11-5-12(16)14(13(17)6-11)20-19-8-10-3-1-9(7-18)2-4-10/h1-6,8,20H |
| InChIKey | ZQRNXQZNMKLZMP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|