C18H12Cl2N6 — CID 25259849
4-[(E)-[[4-chloro-6-(3-chloroanilino)pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile (PubChem CID 25259849) has the molecular formula C18H12Cl2N6 and a molecular weight of 383.24 g/mol. Its IUPAC name is 4-[(E)-[[4-chloro-6-(3-chloroanilino)pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile.
| Compound Name | 4-[(E)-[[4-chloro-6-(3-chloroanilino)pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 25259849 |
| Molecular Formula | C18H12Cl2N6 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-[(E)-[[4-chloro-6-(3-chloroanilino)pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=N/Nc2nc(Cl)cc(Nc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C18H12Cl2N6/c19-14-2-1-3-15(8-14)23-17-9-16(20)24-18(25-17)26-22-11-13-6-4-12(10-21)5-7-13/h1-9,11H,(H2,23,24,25,26)/b22-11+ |
| InChIKey | YHHBXMSKIKFYRH-SSDVNMTOSA-N |
| XLogP | 4.84 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|